C7H10F2O — CID 106796985
1-[1-(2,2-difluoroethyl)cyclopropyl]ethanone (PubChem CID 106796985) has the molecular formula C7H10F2O and a molecular weight of 148.15 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)cyclopropyl]ethanone.
| Compound Name | 1-[1-(2,2-difluoroethyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 106796985 |
| Molecular Formula | C7H10F2O |
| Molecular Weight | 148.15 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)cyclopropyl]ethanone |
| SMILES | CC(=O)C1(CC(F)F)CC1 |
| InChI | InChI=1S/C7H10F2O/c1-5(10)7(2-3-7)4-6(8)9/h6H,2-4H2,1H3 |
| InChIKey | HDHWHVNASVSGRS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |