C8H12F2O2 — CID 79425246
1-(2,2-difluoroethyl)cyclopentane-1-carboxylic acid (PubChem CID 79425246) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79425246 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(CC(F)F)CCCC1 |
| InChI | InChI=1S/C8H12F2O2/c9-6(10)5-8(7(11)12)3-1-2-4-8/h6H,1-5H2,(H,11,12) |
| InChIKey | ZAVMMZBKFUMGRC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |