C9H12F2O2 — CID 126987637
1-(2,2-difluoroethyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 126987637) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 126987637 |
| Molecular Formula | C9H12F2O2 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1(CC(F)F)CC=CCC1 |
| InChI | InChI=1S/C9H12F2O2/c10-7(11)6-9(8(12)13)4-2-1-3-5-9/h1-2,7H,3-6H2,(H,12,13) |
| InChIKey | GTIHBPHZBDMXRC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|