3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid

C7H11F2NO2 — CID 115015302

IUPAC3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid
SMILESCN1CC(CC(F)F)(C(=O)O)C1
InChIInChI=1S/C7H11F2NO2/c1-10-3-7(4-10,6(11)12)2-5(8)9/h5H,2-4H2,1H3,(H,11,12)
InChIKeyCEEPDCFZQJJAAI-UHFFFAOYSA-N
MW179.17 g/mol
LogP0.66
Rot. Bonds3

About 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid

3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid (PubChem CID 115015302) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid.

Molecular Properties

Compound Name3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid
PubChem CID115015302
Molecular FormulaC7H11F2NO2
Molecular Weight179.17 g/mol
Exact Mass179.08
IUPAC Name3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid
SMILESCN1CC(CC(F)F)(C(=O)O)C1
InChIInChI=1S/C7H11F2NO2/c1-10-3-7(4-10,6(11)12)2-5(8)9/h5H,2-4H2,1H3,(H,11,12)
InChIKeyCEEPDCFZQJJAAI-UHFFFAOYSA-N
XLogP0.66
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 50.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid?
The IUPAC name of 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid (CID 115015302) is 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid.
What is the SMILES notation for 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid?
The canonical SMILES for 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid is CN1CC(CC(F)F)(C(=O)O)C1.
What is the InChIKey of 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid?
The InChIKey is CEEPDCFZQJJAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-10-3-7(4-10,6(11)12)2-5(8)9/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid?
3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid has a molecular weight of 179.17 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)-1-methylazetidine-3-carboxylic acid is sourced from PubChem (CID 115015302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).