C12H19F2NO4S — CID 166266298
1-but-3-enylsulfonyl-4-(2,2-difluoroethyl)piperidine-4-carboxylic acid (PubChem CID 166266298) has the molecular formula C12H19F2NO4S and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-but-3-enylsulfonyl-4-(2,2-difluoroethyl)piperidine-4-carboxylic acid.
| Compound Name | 1-but-3-enylsulfonyl-4-(2,2-difluoroethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 166266298 |
| Molecular Formula | C12H19F2NO4S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-but-3-enylsulfonyl-4-(2,2-difluoroethyl)piperidine-4-carboxylic acid |
| SMILES | C=CCCS(=O)(=O)N1CCC(CC(F)F)(C(=O)O)CC1 |
| InChI | InChI=1S/C12H19F2NO4S/c1-2-3-8-20(18,19)15-6-4-12(5-7-15,11(16)17)9-10(13)14/h2,10H,1,3-9H2,(H,16,17) |
| InChIKey | VBBWGZXVOXKACL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|