C11H21NO4S — CID 63149529
1-butylsulfonyl-3-ethylpyrrolidine-3-carboxylic acid (PubChem CID 63149529) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-butylsulfonyl-3-ethylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-butylsulfonyl-3-ethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63149529 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-butylsulfonyl-3-ethylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCS(=O)(=O)N1CCC(CC)(C(=O)O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-3-5-8-17(15,16)12-7-6-11(4-2,9-12)10(13)14/h3-9H2,1-2H3,(H,13,14) |
| InChIKey | FTSZKTJSANMOFC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |