C12H23NO6S2 — CID 63245394
1-(2-methylsulfonylethylsulfonyl)-3-propylpiperidine-3-carboxylic acid (PubChem CID 63245394) has the molecular formula C12H23NO6S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfonyl)-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2-methylsulfonylethylsulfonyl)-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63245394 |
| Molecular Formula | C12H23NO6S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfonyl)-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(S(=O)(=O)CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H23NO6S2/c1-3-5-12(11(14)15)6-4-7-13(10-12)21(18,19)9-8-20(2,16)17/h3-10H2,1-2H3,(H,14,15) |
| InChIKey | XCDRACKAXGAJMU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |