C14H24N2O3 — CID 113465880
1-(but-3-enylcarbamoyl)-4-propylpiperidine-4-carboxylic acid (PubChem CID 113465880) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(but-3-enylcarbamoyl)-4-propylpiperidine-4-carboxylic acid.
| Compound Name | 1-(but-3-enylcarbamoyl)-4-propylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 113465880 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(but-3-enylcarbamoyl)-4-propylpiperidine-4-carboxylic acid |
| SMILES | C=CCCNC(=O)N1CCC(CCC)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H24N2O3/c1-3-5-9-15-13(19)16-10-7-14(6-4-2,8-11-16)12(17)18/h3H,1,4-11H2,2H3,(H,15,19)(H,17,18) |
| InChIKey | BRDYKJCOWDNMJN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|