C7H12F2N2O — CID 130691680
N-[3-(2,2-difluoroethyl)azetidin-3-yl]acetamide (PubChem CID 130691680) has the molecular formula C7H12F2N2O and a molecular weight of 178.18 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethyl)azetidin-3-yl]acetamide.
| Compound Name | N-[3-(2,2-difluoroethyl)azetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 130691680 |
| Molecular Formula | C7H12F2N2O |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-[3-(2,2-difluoroethyl)azetidin-3-yl]acetamide |
| SMILES | CC(=O)NC1(CC(F)F)CNC1 |
| InChI | InChI=1S/C7H12F2N2O/c1-5(12)11-7(2-6(8)9)3-10-4-7/h6,10H,2-4H2,1H3,(H,11,12) |
| InChIKey | LZWIVWFJPZMBSK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |