C9H15F2NO2 — CID 138552375
propan-2-yl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate (PubChem CID 138552375) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is propan-2-yl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate.
| Compound Name | propan-2-yl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 138552375 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | propan-2-yl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate |
| SMILES | CC(C)OC(=O)NC1(CC(F)F)CC1 |
| InChI | InChI=1S/C9H15F2NO2/c1-6(2)14-8(13)12-9(3-4-9)5-7(10)11/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | DYPRVOKDBTUADI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |