C7H10F2O3 — CID 158359703
methyl (2E)-4,4-difluoro-2-(methoxymethylidene)butanoate (PubChem CID 158359703) has the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. Its IUPAC name is methyl (2E)-4,4-difluoro-2-(methoxymethylidene)butanoate.
| Compound Name | methyl (2E)-4,4-difluoro-2-(methoxymethylidene)butanoate |
|---|---|
| PubChem CID | 158359703 |
| Molecular Formula | C7H10F2O3 |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | methyl (2E)-4,4-difluoro-2-(methoxymethylidene)butanoate |
| SMILES | CO/C=C(\CC(F)F)C(=O)OC |
| InChI | InChI=1S/C7H10F2O3/c1-11-4-5(3-6(8)9)7(10)12-2/h4,6H,3H2,1-2H3/b5-4+ |
| InChIKey | VYSCRHFNUKZMQQ-SNAWJCMRSA-N |
| XLogP | 1.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|