methyl 2-ethoxy-3-methoxyprop-2-enoate

C7H12O4 — CID 174521396

IUPACmethyl 2-ethoxy-3-methoxyprop-2-enoate
SMILESCCOC(=COC)C(=O)OC
InChIInChI=1S/C7H12O4/c1-4-11-6(5-9-2)7(8)10-3/h5H,4H2,1-3H3
InChIKeyJJVGLYOMMRJHOX-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.68
Rot. Bonds4

About methyl 2-ethoxy-3-methoxyprop-2-enoate

methyl 2-ethoxy-3-methoxyprop-2-enoate (PubChem CID 174521396) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is methyl 2-ethoxy-3-methoxyprop-2-enoate.

Molecular Properties

Compound Namemethyl 2-ethoxy-3-methoxyprop-2-enoate
PubChem CID174521396
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Namemethyl 2-ethoxy-3-methoxyprop-2-enoate
SMILESCCOC(=COC)C(=O)OC
InChIInChI=1S/C7H12O4/c1-4-11-6(5-9-2)7(8)10-3/h5H,4H2,1-3H3
InChIKeyJJVGLYOMMRJHOX-UHFFFAOYSA-N
XLogP0.68
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-ethoxy-3-methoxyprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-ethoxy-3-methoxyprop-2-enoate?
The IUPAC name of methyl 2-ethoxy-3-methoxyprop-2-enoate (CID 174521396) is methyl 2-ethoxy-3-methoxyprop-2-enoate.
What is the SMILES notation for methyl 2-ethoxy-3-methoxyprop-2-enoate?
The canonical SMILES for methyl 2-ethoxy-3-methoxyprop-2-enoate is CCOC(=COC)C(=O)OC.
What is the InChIKey of methyl 2-ethoxy-3-methoxyprop-2-enoate?
The InChIKey is JJVGLYOMMRJHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-4-11-6(5-9-2)7(8)10-3/h5H,4H2,1-3H3.
What are the key properties of methyl 2-ethoxy-3-methoxyprop-2-enoate?
methyl 2-ethoxy-3-methoxyprop-2-enoate has a molecular weight of 160.17 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethoxy-3-methoxyprop-2-enoate is sourced from PubChem (CID 174521396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).