C14H20O7 — CID 18172894
1-propan-2-yloxy-2-prop-2-enoyloxycyclohexane-1,2-dicarboxylic acid (PubChem CID 18172894) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-propan-2-yloxy-2-prop-2-enoyloxycyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1-propan-2-yloxy-2-prop-2-enoyloxycyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18172894 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-propan-2-yloxy-2-prop-2-enoyloxycyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CC(=O)OC1(C(=O)O)CCCCC1(OC(C)C)C(=O)O |
| InChI | InChI=1S/C14H20O7/c1-4-10(15)21-14(12(18)19)8-6-5-7-13(14,11(16)17)20-9(2)3/h4,9H,1,5-8H2,2-3H3,(H,16,17)(H,18,19) |
| InChIKey | YIWWLBDBLIUZGY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|