C17H26O3 — CID 58734530
(5-methoxy-2-propyl-2-adamantyl) prop-2-enoate (PubChem CID 58734530) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (5-methoxy-2-propyl-2-adamantyl) prop-2-enoate.
| Compound Name | (5-methoxy-2-propyl-2-adamantyl) prop-2-enoate |
|---|---|
| PubChem CID | 58734530 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (5-methoxy-2-propyl-2-adamantyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CCC)C2CC3CC1CC(OC)(C3)C2 |
| InChI | InChI=1S/C17H26O3/c1-4-6-17(20-15(18)5-2)13-7-12-8-14(17)11-16(9-12,10-13)19-3/h5,12-14H,2,4,6-11H2,1,3H3 |
| InChIKey | BJLZTUFXRDKPCL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|