C21H36O7 — CID 175435402
1-adamantyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 175435402) has the molecular formula C21H36O7 and a molecular weight of 400.51 g/mol. Its IUPAC name is 1-adamantyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 1-adamantyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 175435402 |
| Molecular Formula | C21H36O7 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-adamantyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | C=CC(=O)OC12CC3CC(CC(C3)C1)C2.OCCOCCOCCOCCO |
| InChI | InChI=1S/C13H18O2.C8H18O5/c1-2-12(14)15-13-6-9-3-10(7-13)5-11(4-9)8-13;9-1-3-11-5-7-13-8-6-12-4-2-10/h2,9-11H,1,3-8H2;9-10H,1-8H2 |
| InChIKey | YSWPJJUWNCRMEX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|