C18H28O4 — CID 67747019
1-decylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 67747019) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-decylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1-decylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67747019 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-decylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CCCCCCCCCCC1(C(=O)O)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C18H28O4/c1-2-3-4-5-6-7-8-10-13-18(17(21)22)14-11-9-12-15(18)16(19)20/h9,11-12,14-15H,2-8,10,13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YBWYRGOOKBJXBO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|