C14H22INO4 — CID 88655758
1-iodo-2,6-dimethyl-4-pentyl-2,3-dihydropyridine-3,4-dicarboxylic acid (PubChem CID 88655758) has the molecular formula C14H22INO4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 1-iodo-2,6-dimethyl-4-pentyl-2,3-dihydropyridine-3,4-dicarboxylic acid.
| Compound Name | 1-iodo-2,6-dimethyl-4-pentyl-2,3-dihydropyridine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 88655758 |
| Molecular Formula | C14H22INO4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-iodo-2,6-dimethyl-4-pentyl-2,3-dihydropyridine-3,4-dicarboxylic acid |
| SMILES | CCCCCC1(C(=O)O)C=C(C)N(I)C(C)C1C(=O)O |
| InChI | InChI=1S/C14H22INO4/c1-4-5-6-7-14(13(19)20)8-9(2)16(15)10(3)11(14)12(17)18/h8,10-11H,4-7H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | YCCFMKFKOUGDPC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|