C20H43N2O4P — CID 175528314
phosphoric acid;2,3,4-trimethyl-1-tetradecyl-2H-imidazole (PubChem CID 175528314) has the molecular formula C20H43N2O4P and a molecular weight of 406.55 g/mol. Its IUPAC name is phosphoric acid;2,3,4-trimethyl-1-tetradecyl-2H-imidazole.
| Compound Name | phosphoric acid;2,3,4-trimethyl-1-tetradecyl-2H-imidazole |
|---|---|
| PubChem CID | 175528314 |
| Molecular Formula | C20H43N2O4P |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | phosphoric acid;2,3,4-trimethyl-1-tetradecyl-2H-imidazole |
| SMILES | CCCCCCCCCCCCCCN1C=C(C)N(C)C1C.O=P(O)(O)O |
| InChI | InChI=1S/C20H40N2.H3O4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-22-18-19(2)21(4)20(22)3;1-5(2,3)4/h18,20H,5-17H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | YTTYCMYSWBLNTL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|