C20H40N2 — CID 21393912
2-methyl-1,3-dioctyl-2H-imidazole (PubChem CID 21393912) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 2-methyl-1,3-dioctyl-2H-imidazole.
| Compound Name | 2-methyl-1,3-dioctyl-2H-imidazole |
|---|---|
| PubChem CID | 21393912 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 2-methyl-1,3-dioctyl-2H-imidazole |
| SMILES | CCCCCCCCN1C=CN(CCCCCCCC)C1C |
| InChI | InChI=1S/C20H40N2/c1-4-6-8-10-12-14-16-21-18-19-22(20(21)3)17-15-13-11-9-7-5-2/h18-20H,4-17H2,1-3H3 |
| InChIKey | UKXHMCSVSWCEIJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|