C17H34N2 — CID 68900702
1-dodecyl-2,3-dimethyl-2H-imidazole (PubChem CID 68900702) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-dodecyl-2,3-dimethyl-2H-imidazole.
| Compound Name | 1-dodecyl-2,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 68900702 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-dodecyl-2,3-dimethyl-2H-imidazole |
| SMILES | CCCCCCCCCCCCN1C=CN(C)C1C |
| InChI | InChI=1S/C17H34N2/c1-4-5-6-7-8-9-10-11-12-13-14-19-16-15-18(3)17(19)2/h15-17H,4-14H2,1-3H3 |
| InChIKey | DZRODCJOAAIUSA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|