C21H42BF4N2- — CID 174775383
1-hexadecyl-2,3-dimethyl-2H-imidazole tetrafluoroborate (PubChem CID 174775383) has the molecular formula C21H42BF4N2- and a molecular weight of 409.39 g/mol. Its IUPAC name is 1-hexadecyl-2,3-dimethyl-2H-imidazole tetrafluoroborate.
| Compound Name | 1-hexadecyl-2,3-dimethyl-2H-imidazole tetrafluoroborate |
|---|---|
| PubChem CID | 174775383 |
| Molecular Formula | C21H42BF4N2- |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.34 |
| IUPAC Name | 1-hexadecyl-2,3-dimethyl-2H-imidazole tetrafluoroborate |
| SMILES | CCCCCCCCCCCCCCCCN1C=CN(C)C1C.F[B-](F)(F)F |
| InChI | InChI=1S/C21H42N2.BF4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20-19-22(3)21(23)2;2-1(3,4)5/h19-21H,4-18H2,1-3H3;/q;-1 |
| InChIKey | KHZBYCLYLYRILO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|