C9H18N2O — CID 175203047
1-butyl-2,3-dimethyl-2H-imidazol-4-ol (PubChem CID 175203047) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-butyl-2,3-dimethyl-2H-imidazol-4-ol.
| Compound Name | 1-butyl-2,3-dimethyl-2H-imidazol-4-ol |
|---|---|
| PubChem CID | 175203047 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-butyl-2,3-dimethyl-2H-imidazol-4-ol |
| SMILES | CCCCN1C=C(O)N(C)C1C |
| InChI | InChI=1S/C9H18N2O/c1-4-5-6-11-7-9(12)10(3)8(11)2/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | MCPQHWABNMXRJU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |