About 1-butyl-2,3-dimethyl-2H-imidazol-4-ol
1-butyl-2,3-dimethyl-2H-imidazol-4-ol (PubChem CID 175203047) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-butyl-2,3-dimethyl-2H-imidazol-4-ol.
Molecular Properties
| Compound Name | 1-butyl-2,3-dimethyl-2H-imidazol-4-ol |
| PubChem CID | 175203047 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-butyl-2,3-dimethyl-2H-imidazol-4-ol |
| SMILES | CCCCN1C=C(O)N(C)C1C |
| InChI | InChI=1S/C9H18N2O/c1-4-5-6-11-7-9(12)10(3)8(11)2/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | MCPQHWABNMXRJU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2,3-dimethyl-2H-imidazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,3-dimethyl-2H-imidazol-4-ol?
The IUPAC name of 1-butyl-2,3-dimethyl-2H-imidazol-4-ol (CID 175203047) is 1-butyl-2,3-dimethyl-2H-imidazol-4-ol.
What is the SMILES notation for 1-butyl-2,3-dimethyl-2H-imidazol-4-ol?
The canonical SMILES for 1-butyl-2,3-dimethyl-2H-imidazol-4-ol is CCCCN1C=C(O)N(C)C1C.
What is the InChIKey of 1-butyl-2,3-dimethyl-2H-imidazol-4-ol?
The InChIKey is MCPQHWABNMXRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-4-5-6-11-7-9(12)10(3)8(11)2/h7-8,12H,4-6H2,1-3H3.
What are the key properties of 1-butyl-2,3-dimethyl-2H-imidazol-4-ol?
1-butyl-2,3-dimethyl-2H-imidazol-4-ol has a molecular weight of 170.26 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,3-dimethyl-2H-imidazol-4-ol is sourced from PubChem (CID 175203047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).