C34H56O8 — CID 161253424
4-methylcyclohex-4-ene-1,2-dicarboxylic acid;4-methyl-1,2-dioctylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 161253424) has the molecular formula C34H56O8 and a molecular weight of 592.81 g/mol. Its IUPAC name is 4-methylcyclohex-4-ene-1,2-dicarboxylic acid;4-methyl-1,2-dioctylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | 4-methylcyclohex-4-ene-1,2-dicarboxylic acid;4-methyl-1,2-dioctylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 161253424 |
| Molecular Formula | C34H56O8 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 4-methylcyclohex-4-ene-1,2-dicarboxylic acid;4-methyl-1,2-dioctylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | CC1=CCC(C(=O)O)C(C(=O)O)C1.CCCCCCCCC1(C(=O)O)CC=C(C)CC1(CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C25H44O4.C9H12O4/c1-4-6-8-10-12-14-17-24(22(26)27)19-16-21(3)20-25(24,23(28)29)18-15-13-11-9-7-5-2;1-5-2-3-6(8(10)11)7(4-5)9(12)13/h16H,4-15,17-20H2,1-3H3,(H,26,27)(H,28,29);2,6-7H,3-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | VBOQASOUKODOQF-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|