C14H22O4 — CID 146562587
(1S,2S)-1,2-dipropylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 146562587) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,2S)-1,2-dipropylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | (1S,2S)-1,2-dipropylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 146562587 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1S,2S)-1,2-dipropylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | CCC[C@]1(C(=O)O)CC=CC[C@]1(CCC)C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h5-6H,3-4,7-10H2,1-2H3,(H,15,16)(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | OMXNOUNHGOMSFB-ZIAGYGMSSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|