C13H20O4 — CID 146562606
(1S,2S)-1-ethyl-2-propylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 146562606) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,2S)-1-ethyl-2-propylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | (1S,2S)-1-ethyl-2-propylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 146562606 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (1S,2S)-1-ethyl-2-propylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | CCC[C@]1(C(=O)O)CC=CC[C@]1(CC)C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-3-7-13(11(16)17)9-6-5-8-12(13,4-2)10(14)15/h5-6H,3-4,7-9H2,1-2H3,(H,14,15)(H,16,17)/t12-,13-/m1/s1 |
| InChIKey | RMHABGAHHGSLKE-CHWSQXEVSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|