C24H36Br4O4 — CID 70247389
3,4,5,6-tetrabromo-1,2-dioctylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70247389) has the molecular formula C24H36Br4O4 and a molecular weight of 708.16 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1,2-dioctylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1,2-dioctylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70247389 |
| Molecular Formula | C24H36Br4O4 |
| Molecular Weight | 708.16 g/mol |
| Exact Mass | 703.93 |
| IUPAC Name | 3,4,5,6-tetrabromo-1,2-dioctylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CCCCCCCCC1(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C1(CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C24H36Br4O4/c1-3-5-7-9-11-13-15-23(21(29)30)19(27)17(25)18(26)20(28)24(23,22(31)32)16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | XATFMWAMTDRQFQ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.16 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|