C11H12O5 — CID 150625648
1-(oxiran-2-ylmethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 150625648) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1-(oxiran-2-ylmethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 150625648 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(oxiran-2-ylmethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1C=CC=CC1(CC1CO1)C(=O)O |
| InChI | InChI=1S/C11H12O5/c12-9(13)8-3-1-2-4-11(8,10(14)15)5-7-6-16-7/h1-4,7-8H,5-6H2,(H,12,13)(H,14,15) |
| InChIKey | IWVFDOHEHYSRSL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|