C13H20O5 — CID 174608641
3,6-dimethyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 174608641) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,6-dimethyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 3,6-dimethyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174608641 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3,6-dimethyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CC1CCC(C)C(CC2CO2)(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C13H20O5/c1-7-3-4-8(2)13(12(16)17,5-9-6-18-9)10(7)11(14)15/h7-10H,3-6H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | STDBVFKFSLOSKT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|