C9H12O2 — CID 118902201
1-(oxiran-2-ylmethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 118902201) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(oxiran-2-ylmethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 118902201 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-(oxiran-2-ylmethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1(CC2CO2)C=CC=CC1 |
| InChI | InChI=1S/C9H12O2/c10-9(6-8-7-11-8)4-2-1-3-5-9/h1-4,8,10H,5-7H2 |
| InChIKey | ZGSKXRRCCAGZGE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|