C9H14O2 — CID 129321679
(1R,3R)-5-ethenyl-1-methylcyclohex-4-ene-1,3-diol (PubChem CID 129321679) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1R,3R)-5-ethenyl-1-methylcyclohex-4-ene-1,3-diol.
| Compound Name | (1R,3R)-5-ethenyl-1-methylcyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 129321679 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1R,3R)-5-ethenyl-1-methylcyclohex-4-ene-1,3-diol |
| SMILES | C=CC1=C[C@H](O)C[C@](C)(O)C1 |
| InChI | InChI=1S/C9H14O2/c1-3-7-4-8(10)6-9(2,11)5-7/h3-4,8,10-11H,1,5-6H2,2H3/t8-,9+/m0/s1 |
| InChIKey | YYVUSFIKLGPIHT-DTWKUNHWSA-N |
| XLogP | 1.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |