C11H15NO3 — CID 87956536
6-methyl-6-[[(2S)-oxiran-2-yl]methoxy]cyclohexa-2,4-diene-1-carboxamide (PubChem CID 87956536) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 6-methyl-6-[[(2S)-oxiran-2-yl]methoxy]cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-methyl-6-[[(2S)-oxiran-2-yl]methoxy]cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 87956536 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 6-methyl-6-[[(2S)-oxiran-2-yl]methoxy]cyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC1(OC[C@@H]2CO2)C=CC=CC1C(N)=O |
| InChI | InChI=1S/C11H15NO3/c1-11(15-7-8-6-14-8)5-3-2-4-9(11)10(12)13/h2-5,8-9H,6-7H2,1H3,(H2,12,13)/t8-,9?,11?/m0/s1 |
| InChIKey | AXDLXUIDXGDVFU-SILCLGDVSA-N |
| XLogP | 0.39 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|