C7H7F2NO — CID 150573434
6,6-difluorocyclohexa-2,4-diene-1-carboxamide (PubChem CID 150573434) has the molecular formula C7H7F2NO and a molecular weight of 159.13 g/mol. Its IUPAC name is 6,6-difluorocyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6,6-difluorocyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 150573434 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.13 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 6,6-difluorocyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(F)F |
| InChI | InChI=1S/C7H7F2NO/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H2,10,11) |
| InChIKey | IMHYSNJDAIAZIK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |