C9H14N2O2 — CID 151394217
6-methoxy-6-methylcyclohexa-2,4-diene-1-carbohydrazide (PubChem CID 151394217) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-methoxy-6-methylcyclohexa-2,4-diene-1-carbohydrazide.
| Compound Name | 6-methoxy-6-methylcyclohexa-2,4-diene-1-carbohydrazide |
|---|---|
| PubChem CID | 151394217 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 6-methoxy-6-methylcyclohexa-2,4-diene-1-carbohydrazide |
| SMILES | COC1(C)C=CC=CC1C(=O)NN |
| InChI | InChI=1S/C9H14N2O2/c1-9(13-2)6-4-3-5-7(9)8(12)11-10/h3-7H,10H2,1-2H3,(H,11,12) |
| InChIKey | OVCDZRLOPFQAFK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|