C8H13N5O2 — CID 66811964
1-aminocyclohexa-3,5-diene-1,2-dicarbohydrazide (PubChem CID 66811964) has the molecular formula C8H13N5O2 and a molecular weight of 211.23 g/mol. Its IUPAC name is 1-aminocyclohexa-3,5-diene-1,2-dicarbohydrazide.
| Compound Name | 1-aminocyclohexa-3,5-diene-1,2-dicarbohydrazide |
|---|---|
| PubChem CID | 66811964 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-aminocyclohexa-3,5-diene-1,2-dicarbohydrazide |
| SMILES | NNC(=O)C1C=CC=CC1(N)C(=O)NN |
| InChI | InChI=1S/C8H13N5O2/c9-8(7(15)13-11)4-2-1-3-5(8)6(14)12-10/h1-5H,9-11H2,(H,12,14)(H,13,15) |
| InChIKey | IPQCDHUZDPVNJZ-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|