About oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate
oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate (PubChem CID 110189647) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate |
| PubChem CID | 110189647 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC2CO2)CC1 |
| InChI | InChI=1S/C8H12O3/c1-8(2-3-8)7(9)11-5-6-4-10-6/h6H,2-5H2,1H3 |
| InChIKey | DPFSHKAKXUERDX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate?
The IUPAC name of oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate (CID 110189647) is oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate?
The canonical SMILES for oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate is CC1(C(=O)OCC2CO2)CC1.
What is the InChIKey of oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate?
The InChIKey is DPFSHKAKXUERDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-8(2-3-8)7(9)11-5-6-4-10-6/h6H,2-5H2,1H3.
What are the key properties of oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate?
oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate has a molecular weight of 156.18 g/mol, XLogP of 0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 110189647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).