C12H16O6 — CID 87668988
6-(methoxymethoxy)-6-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 87668988) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 6-(methoxymethoxy)-6-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(methoxymethoxy)-6-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 87668988 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 6-(methoxymethoxy)-6-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COCOC1(OCC2CO2)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C12H16O6/c1-15-8-18-12(17-7-9-6-16-9)5-3-2-4-10(12)11(13)14/h2-5,9-10H,6-8H2,1H3,(H,13,14) |
| InChIKey | OVABKNYUMJJWIC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|