C12H16BF5O2 — CID 141064374
(2,3,4,5,6-pentafluoro-1-hexylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 141064374) has the molecular formula C12H16BF5O2 and a molecular weight of 298.06 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluoro-1-hexylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (2,3,4,5,6-pentafluoro-1-hexylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 141064374 |
| Molecular Formula | C12H16BF5O2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2,3,4,5,6-pentafluoro-1-hexylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CCCCCCC1(B(O)O)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C12H16BF5O2/c1-2-3-4-5-6-12(13(19)20)10(17)8(15)7(14)9(16)11(12)18/h10,19-20H,2-6H2,1H3 |
| InChIKey | UTRWEKUYFBIBGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|