About (4-decoxyphenoxy)boronic acid
(4-decoxyphenoxy)boronic acid (PubChem CID 54526800) has the molecular formula C16H27BO4
and a molecular weight of 294.20 g/mol. Its IUPAC name is (4-decoxyphenoxy)boronic acid.
Molecular Properties
| Compound Name | (4-decoxyphenoxy)boronic acid |
| PubChem CID | 54526800 |
| Molecular Formula | C16H27BO4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (4-decoxyphenoxy)boronic acid |
| SMILES | CCCCCCCCCCOc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C16H27BO4/c1-2-3-4-5-6-7-8-9-14-20-15-10-12-16(13-11-15)21-17(18)19/h10-13,18-19H,2-9,14H2,1H3 |
| InChIKey | YTRRBGFSUJADRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-decoxyphenoxy)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-decoxyphenoxy)boronic acid?
The IUPAC name of (4-decoxyphenoxy)boronic acid (CID 54526800) is (4-decoxyphenoxy)boronic acid.
What is the SMILES notation for (4-decoxyphenoxy)boronic acid?
The canonical SMILES for (4-decoxyphenoxy)boronic acid is CCCCCCCCCCOc1ccc(OB(O)O)cc1.
What is the InChIKey of (4-decoxyphenoxy)boronic acid?
The InChIKey is YTRRBGFSUJADRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27BO4/c1-2-3-4-5-6-7-8-9-14-20-15-10-12-16(13-11-15)21-17(18)19/h10-13,18-19H,2-9,14H2,1H3.
What are the key properties of (4-decoxyphenoxy)boronic acid?
(4-decoxyphenoxy)boronic acid has a molecular weight of 294.20 g/mol, XLogP of 3.55, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-decoxyphenoxy)boronic acid is sourced from PubChem (CID 54526800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).