C4H2ClF5 — CID 96565592
cis-(3R,4R)-3-chloro-1,1,2,2,4-pentafluorocyclobutane (PubChem CID 96565592) has the molecular formula C4H2ClF5 and a molecular weight of 180.50 g/mol. Its IUPAC name is cis-(3R,4R)-3-chloro-1,1,2,2,4-pentafluorocyclobutane.
| Compound Name | cis-(3R,4R)-3-chloro-1,1,2,2,4-pentafluorocyclobutane |
|---|---|
| PubChem CID | 96565592 |
| Molecular Formula | C4H2ClF5 |
| Molecular Weight | 180.50 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | cis-(3R,4R)-3-chloro-1,1,2,2,4-pentafluorocyclobutane |
| SMILES | F[C@H]1[C@@H](Cl)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4H2ClF5/c5-1-2(6)4(9,10)3(1,7)8/h1-2H/t1-,2+/m1/s1 |
| InChIKey | TUQAWSUXFUXTIQ-NCGGTJAESA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|