C6H4Cl7F — CID 118578864
1,1,2,3,4,5,6-heptachloro-4-fluorocyclohexane (PubChem CID 118578864) has the molecular formula C6H4Cl7F and a molecular weight of 343.27 g/mol. Its IUPAC name is 1,1,2,3,4,5,6-heptachloro-4-fluorocyclohexane.
| Compound Name | 1,1,2,3,4,5,6-heptachloro-4-fluorocyclohexane |
|---|---|
| PubChem CID | 118578864 |
| Molecular Formula | C6H4Cl7F |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 339.81 |
| IUPAC Name | 1,1,2,3,4,5,6-heptachloro-4-fluorocyclohexane |
| SMILES | FC1(Cl)C(Cl)C(Cl)C(Cl)(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H4Cl7F/c7-1-3(9)6(13,14)4(10)2(8)5(1,11)12/h1-4H |
| InChIKey | PYONQADORACFBS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|