C6H2ClF9 — CID 98117627
trans-(4R,5R)-4-chloro-1,1,2,2,3,3-hexafluoro-5-(trifluoromethyl)cyclopentane (PubChem CID 98117627) has the molecular formula C6H2ClF9 and a molecular weight of 280.52 g/mol. Its IUPAC name is trans-(4R,5R)-4-chloro-1,1,2,2,3,3-hexafluoro-5-(trifluoromethyl)cyclopentane.
| Compound Name | trans-(4R,5R)-4-chloro-1,1,2,2,3,3-hexafluoro-5-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 98117627 |
| Molecular Formula | C6H2ClF9 |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | trans-(4R,5R)-4-chloro-1,1,2,2,3,3-hexafluoro-5-(trifluoromethyl)cyclopentane |
| SMILES | FC(F)(F)[C@@H]1[C@@H](Cl)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H2ClF9/c7-2-1(5(12,13)14)3(8,9)6(15,16)4(2,10)11/h1-2H/t1-,2-/m1/s1 |
| InChIKey | KQTKOKIFRWGIAH-JCYAYHJZSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|