C4H4BF3K2O3 — CID 175031838
dipotassium;dioxido-(2,2,3-trifluoro-1-methylcyclopropyl)oxyborane (PubChem CID 175031838) has the molecular formula C4H4BF3K2O3 and a molecular weight of 246.07 g/mol. Its IUPAC name is dipotassium;dioxido-(2,2,3-trifluoro-1-methylcyclopropyl)oxyborane.
| Compound Name | dipotassium;dioxido-(2,2,3-trifluoro-1-methylcyclopropyl)oxyborane |
|---|---|
| PubChem CID | 175031838 |
| Molecular Formula | C4H4BF3K2O3 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | dipotassium;dioxido-(2,2,3-trifluoro-1-methylcyclopropyl)oxyborane |
| SMILES | CC1(OB([O-])[O-])C(F)C1(F)F.[K+].[K+] |
| InChI | InChI=1S/C4H4BF3O3.2K/c1-3(11-5(9)10)2(6)4(3,7)8;;/h2H,1H3;;/q-2;2*+1 |
| InChIKey | ANLWEZLJBHJPOA-UHFFFAOYSA-N |
| XLogP | -7.54 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | -7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|