C3H2BF3K2O3 — CID 66779980
dipotassium;dioxido-(1,2,2-trifluorocyclopropyl)oxyborane (PubChem CID 66779980) has the molecular formula C3H2BF3K2O3 and a molecular weight of 232.05 g/mol. Its IUPAC name is dipotassium;dioxido-(1,2,2-trifluorocyclopropyl)oxyborane.
| Compound Name | dipotassium;dioxido-(1,2,2-trifluorocyclopropyl)oxyborane |
|---|---|
| PubChem CID | 66779980 |
| Molecular Formula | C3H2BF3K2O3 |
| Molecular Weight | 232.05 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | dipotassium;dioxido-(1,2,2-trifluorocyclopropyl)oxyborane |
| SMILES | [K+].[K+].[O-]B([O-])OC1(F)CC1(F)F |
| InChI | InChI=1S/C3H2BF3O3.2K/c5-2(6)1-3(2,7)10-4(8)9;;/h1H2;;/q-2;2*+1 |
| InChIKey | UHMXCPWTCGMMEH-UHFFFAOYSA-N |
| XLogP | -7.58 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.05 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|