C6H8BF3O3 — CID 170556660
(1,2,2-trifluoro-3-oxabicyclo[4.1.0]heptan-6-yl)boronic acid (PubChem CID 170556660) has the molecular formula C6H8BF3O3 and a molecular weight of 195.93 g/mol. Its IUPAC name is (1,2,2-trifluoro-3-oxabicyclo[4.1.0]heptan-6-yl)boronic acid.
| Compound Name | (1,2,2-trifluoro-3-oxabicyclo[4.1.0]heptan-6-yl)boronic acid |
|---|---|
| PubChem CID | 170556660 |
| Molecular Formula | C6H8BF3O3 |
| Molecular Weight | 195.93 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (1,2,2-trifluoro-3-oxabicyclo[4.1.0]heptan-6-yl)boronic acid |
| SMILES | OB(O)C12CCOC(F)(F)C1(F)C2 |
| InChI | InChI=1S/C6H8BF3O3/c8-5-3-4(5,7(11)12)1-2-13-6(5,9)10/h11-12H,1-3H2 |
| InChIKey | KKJCIOIHJSHUAP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.93 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|