About 2,2-difluorooxetane;fluoromethane;molecular fluorine
2,2-difluorooxetane;fluoromethane;molecular fluorine (PubChem CID 157131150) has the molecular formula C4H7F5O
and a molecular weight of 166.09 g/mol. Its IUPAC name is 2,2-difluorooxetane;fluoromethane;molecular fluorine.
Molecular Properties
| Compound Name | 2,2-difluorooxetane;fluoromethane;molecular fluorine |
| PubChem CID | 157131150 |
| Molecular Formula | C4H7F5O |
| Molecular Weight | 166.09 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 2,2-difluorooxetane;fluoromethane;molecular fluorine |
| SMILES | CF.FC1(F)CCO1.FF |
| InChI | InChI=1S/C3H4F2O.CH3F.F2/c4-3(5)1-2-6-3;2*1-2/h1-2H2;1H3; |
| InChIKey | AJBZCZDLANGHHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluorooxetane;fluoromethane;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluorooxetane;fluoromethane;molecular fluorine?
The IUPAC name of 2,2-difluorooxetane;fluoromethane;molecular fluorine (CID 157131150) is 2,2-difluorooxetane;fluoromethane;molecular fluorine.
What is the SMILES notation for 2,2-difluorooxetane;fluoromethane;molecular fluorine?
The canonical SMILES for 2,2-difluorooxetane;fluoromethane;molecular fluorine is CF.FC1(F)CCO1.FF.
What is the InChIKey of 2,2-difluorooxetane;fluoromethane;molecular fluorine?
The InChIKey is AJBZCZDLANGHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F2O.CH3F.F2/c4-3(5)1-2-6-3;2*1-2/h1-2H2;1H3;.
What are the key properties of 2,2-difluorooxetane;fluoromethane;molecular fluorine?
2,2-difluorooxetane;fluoromethane;molecular fluorine has a molecular weight of 166.09 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluorooxetane;fluoromethane;molecular fluorine is sourced from PubChem (CID 157131150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).