About 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane
2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane (PubChem CID 91569034) has the molecular formula C9H19F3O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane.
Molecular Properties
| Compound Name | 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane |
| PubChem CID | 91569034 |
| Molecular Formula | C9H19F3O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane |
| SMILES | CCC1(F)CCCO1.CCF.CF |
| InChI | InChI=1S/C6H11FO.C2H5F.CH3F/c1-2-6(7)4-3-5-8-6;1-2-3;1-2/h2-5H2,1H3;2H2,1H3;1H3 |
| InChIKey | LAVKYVDCCBKBEG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane?
The IUPAC name of 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane (CID 91569034) is 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane.
What is the SMILES notation for 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane?
The canonical SMILES for 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane is CCC1(F)CCCO1.CCF.CF.
What is the InChIKey of 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane?
The InChIKey is LAVKYVDCCBKBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO.C2H5F.CH3F/c1-2-6(7)4-3-5-8-6;1-2-3;1-2/h2-5H2,1H3;2H2,1H3;1H3.
What are the key properties of 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane?
2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane has a molecular weight of 200.24 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-fluorooxolane;fluoroethane;fluoromethane is sourced from PubChem (CID 91569034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).