C10H23NO3 — CID 175310539
N,N-diethylethanamine;oxolane-2,2-diol (PubChem CID 175310539) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N,N-diethylethanamine;oxolane-2,2-diol.
| Compound Name | N,N-diethylethanamine;oxolane-2,2-diol |
|---|---|
| PubChem CID | 175310539 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | N,N-diethylethanamine;oxolane-2,2-diol |
| SMILES | CCN(CC)CC.OC1(O)CCCO1 |
| InChI | InChI=1S/C6H15N.C4H8O3/c1-4-7(5-2)6-3;5-4(6)2-1-3-7-4/h4-6H2,1-3H3;5-6H,1-3H2 |
| InChIKey | HVAPHKNTHXGPMK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|