About acetonitrile;cyclohexane;N,N-diethylethanamine
acetonitrile;cyclohexane;N,N-diethylethanamine (PubChem CID 23094312) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is acetonitrile;cyclohexane;N,N-diethylethanamine.
Molecular Properties
| Compound Name | acetonitrile;cyclohexane;N,N-diethylethanamine |
| PubChem CID | 23094312 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | acetonitrile;cyclohexane;N,N-diethylethanamine |
| SMILES | C1CCCCC1.CC#N.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C6H12.C2H3N/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;1-2-3/h4-6H2,1-3H3;1-6H2;1H3 |
| InChIKey | RYFXTWHDUGIVEC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;cyclohexane;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;cyclohexane;N,N-diethylethanamine?
The IUPAC name of acetonitrile;cyclohexane;N,N-diethylethanamine (CID 23094312) is acetonitrile;cyclohexane;N,N-diethylethanamine.
What is the SMILES notation for acetonitrile;cyclohexane;N,N-diethylethanamine?
The canonical SMILES for acetonitrile;cyclohexane;N,N-diethylethanamine is C1CCCCC1.CC#N.CCN(CC)CC.
What is the InChIKey of acetonitrile;cyclohexane;N,N-diethylethanamine?
The InChIKey is RYFXTWHDUGIVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C6H12.C2H3N/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;1-2-3/h4-6H2,1-3H3;1-6H2;1H3.
What are the key properties of acetonitrile;cyclohexane;N,N-diethylethanamine?
acetonitrile;cyclohexane;N,N-diethylethanamine has a molecular weight of 226.41 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;cyclohexane;N,N-diethylethanamine is sourced from PubChem (CID 23094312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).