About cyanic acid;N,N-diethylethanamine
cyanic acid;N,N-diethylethanamine (PubChem CID 14848642) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is cyanic acid;N,N-diethylethanamine.
Molecular Properties
| Compound Name | cyanic acid;N,N-diethylethanamine |
| PubChem CID | 14848642 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | cyanic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.N#CO |
| InChI | InChI=1S/C6H15N.CHNO/c1-4-7(5-2)6-3;2-1-3/h4-6H2,1-3H3;3H |
| InChIKey | TYAQNGCKFDJESH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;N,N-diethylethanamine?
The IUPAC name of cyanic acid;N,N-diethylethanamine (CID 14848642) is cyanic acid;N,N-diethylethanamine.
What is the SMILES notation for cyanic acid;N,N-diethylethanamine?
The canonical SMILES for cyanic acid;N,N-diethylethanamine is CCN(CC)CC.N#CO.
What is the InChIKey of cyanic acid;N,N-diethylethanamine?
The InChIKey is TYAQNGCKFDJESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CHNO/c1-4-7(5-2)6-3;2-1-3/h4-6H2,1-3H3;3H.
What are the key properties of cyanic acid;N,N-diethylethanamine?
cyanic acid;N,N-diethylethanamine has a molecular weight of 144.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;N,N-diethylethanamine is sourced from PubChem (CID 14848642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).