C10H12F8O — CID 161268792
2,2,3,3,10,10,11,11-octafluoro-oxacycloundecane (PubChem CID 161268792) has the molecular formula C10H12F8O and a molecular weight of 300.19 g/mol. Its IUPAC name is 2,2,3,3,10,10,11,11-octafluoro-oxacycloundecane.
| Compound Name | 2,2,3,3,10,10,11,11-octafluoro-oxacycloundecane |
|---|---|
| PubChem CID | 161268792 |
| Molecular Formula | C10H12F8O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2,2,3,3,10,10,11,11-octafluoro-oxacycloundecane |
| SMILES | FC1(F)CCCCCCC(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C10H12F8O/c11-7(12)5-3-1-2-4-6-8(13,14)10(17,18)19-9(7,15)16/h1-6H2 |
| InChIKey | VDNPETCDBCMPQT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|